C27H48Cl2N2 — CID 46866182
N'-(2-adamantyl)-N-[(2E,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 46866182) has the molecular formula C27H48Cl2N2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N'-(2-adamantyl)-N-[(2E,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N'-(2-adamantyl)-N-[(2E,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 46866182 |
| Molecular Formula | C27H48Cl2N2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | N'-(2-adamantyl)-N-[(2E,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C/CNCCNC1C2CC3CC(C2)CC1C3.Cl.Cl |
| InChI | InChI=1S/C27H46N2.2ClH/c1-20(2)7-5-8-21(3)9-6-10-22(4)11-12-28-13-14-29-27-25-16-23-15-24(18-25)19-26(27)17-23;;/h7,9,11,23-29H,5-6,8,10,12-19H2,1-4H3;2*1H/b21-9-,22-11+;; |
| InChIKey | AIBBLNHJSFICRD-MNNCWCMOSA-N |
| XLogP | 7.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|