C24H43NO — CID 144804929
(2E)-N-[3-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]propyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 144804929) has the molecular formula C24H43NO and a molecular weight of 361.61 g/mol. Its IUPAC name is (2E)-N-[3-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]propyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2E)-N-[3-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]propyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 144804929 |
| Molecular Formula | C24H43NO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.33 |
| IUPAC Name | (2E)-N-[3-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)oxy]propyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCCOC1C(C)CC2CC(C)CC1C2 |
| InChI | InChI=1S/C24H43NO/c1-18(2)8-6-9-19(3)10-12-25-11-7-13-26-24-21(5)16-22-14-20(4)15-23(24)17-22/h8,10,20-25H,6-7,9,11-17H2,1-5H3/b19-10+ |
| InChIKey | IQEWXWCVPAWHRE-VXLYETTFSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|