C20H40N2 — CID 143948031
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-(2-methyl-4-methylidenecyclohexyl)ethane-1,2-diamine;molecular hydrogen (PubChem CID 143948031) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-(2-methyl-4-methylidenecyclohexyl)ethane-1,2-diamine;molecular hydrogen.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-(2-methyl-4-methylidenecyclohexyl)ethane-1,2-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 143948031 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-(2-methyl-4-methylidenecyclohexyl)ethane-1,2-diamine;molecular hydrogen |
| SMILES | C=C1CCC(NCCNC/C=C(\C)CCC=C(C)C)C(C)C1.[H][H].[H][H] |
| InChI | InChI=1S/C20H36N2.2H2/c1-16(2)7-6-8-17(3)11-12-21-13-14-22-20-10-9-18(4)15-19(20)5;;/h7,11,19-22H,4,6,8-10,12-15H2,1-3,5H3;2*1H/b17-11+;; |
| InChIKey | XTQYSEKUTSAZJS-HSZLIDMQSA-N |
| XLogP | 5.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|