C23H34N2O — CID 66572385
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[(1R,2S,3R,4R,6S,7R,8S,9S,10S,12S)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]ethane-1,2-diamine (PubChem CID 66572385) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[(1R,2S,3R,4R,6S,7R,8S,9S,10S,12S)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]ethane-1,2-diamine.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[(1R,2S,3R,4R,6S,7R,8S,9S,10S,12S)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 66572385 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N'-[(1R,2S,3R,4R,6S,7R,8S,9S,10S,12S)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecan-4-yl]ethane-1,2-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCN[C@]12O[C@@H]3[C@@H]4[C@H]5[C@H]6C[C@@H]([C@@H]5[C@@H]41)[C@@H]2[C@H]63 |
| InChI | InChI=1S/C23H34N2O/c1-12(2)5-4-6-13(3)7-8-24-9-10-25-23-20-15-11-14-16-17(15)21(23)19(16)22(26-23)18(14)20/h5,7,14-22,24-25H,4,6,8-11H2,1-3H3/b13-7+/t14-,15+,16+,17+,18+,19-,20-,21+,22+,23-/m1/s1 |
| InChIKey | QQXUUMQSOLWVHI-UXNTZJQISA-N |
| XLogP | 3.34 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|