C30H49N — CID 123302484
N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)adamantan-1-amine (PubChem CID 123302484) has the molecular formula C30H49N and a molecular weight of 423.73 g/mol. Its IUPAC name is N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)adamantan-1-amine.
| Compound Name | N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)adamantan-1-amine |
|---|---|
| PubChem CID | 123302484 |
| Molecular Formula | C30H49N |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | N-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)adamantan-1-amine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H49N/c1-23(2)9-6-10-24(3)11-7-12-25(4)13-8-14-26(5)15-16-31-30-20-27-17-28(21-30)19-29(18-27)22-30/h9,11,13,15,27-29,31H,6-8,10,12,14,16-22H2,1-5H3 |
| InChIKey | ZDUFRBWBWMIAFU-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|