C10H18ClN — CID 141263523
(2E)-N-chloro-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 141263523) has the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. Its IUPAC name is (2E)-N-chloro-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2E)-N-chloro-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 141263523 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2E)-N-chloro-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNCl |
| InChI | InChI=1S/C10H18ClN/c1-9(2)5-4-6-10(3)7-8-12-11/h5,7,12H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | GTRUJIUIEDGTRD-JXMROGBWSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|