C12H21NO — CID 14993064
N-[(2Z)-3,7-dimethylocta-2,6-dienyl]acetamide (PubChem CID 14993064) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-[(2Z)-3,7-dimethylocta-2,6-dienyl]acetamide.
| Compound Name | N-[(2Z)-3,7-dimethylocta-2,6-dienyl]acetamide |
|---|---|
| PubChem CID | 14993064 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-[(2Z)-3,7-dimethylocta-2,6-dienyl]acetamide |
| SMILES | CC(=O)NC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C12H21NO/c1-10(2)6-5-7-11(3)8-9-13-12(4)14/h6,8H,5,7,9H2,1-4H3,(H,13,14)/b11-8- |
| InChIKey | CJEIWYRAGBZMAB-FLIBITNWSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|