C12H21NO2 — CID 10656136
methyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate (PubChem CID 10656136) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is methyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate.
| Compound Name | methyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate |
|---|---|
| PubChem CID | 10656136 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | methyl N-[(2E)-3,7-dimethylocta-2,6-dienyl]carbamate |
| SMILES | COC(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C12H21NO2/c1-10(2)6-5-7-11(3)8-9-13-12(14)15-4/h6,8H,5,7,9H2,1-4H3,(H,13,14)/b11-8+ |
| InChIKey | RRFZUOUFCPJJIK-DHZHZOJOSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|