C27H47N3O5 — CID 158673741
N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methyloxamide;methane;methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate (PubChem CID 158673741) has the molecular formula C27H47N3O5 and a molecular weight of 493.69 g/mol. Its IUPAC name is N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methyloxamide;methane;methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate.
| Compound Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methyloxamide;methane;methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 158673741 |
| Molecular Formula | C27H47N3O5 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.35 |
| IUPAC Name | N'-[(2E)-3,7-dimethylocta-2,6-dienyl]-N-methyloxamide;methane;methyl 2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-2-oxoacetate |
| SMILES | C.CNC(=O)C(=O)NC/C=C(\C)CCC=C(C)C.COC(=O)C(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H22N2O2.C13H21NO3.CH4/c1-10(2)6-5-7-11(3)8-9-15-13(17)12(16)14-4;1-10(2)6-5-7-11(3)8-9-14-12(15)13(16)17-4;/h6,8H,5,7,9H2,1-4H3,(H,14,16)(H,15,17);6,8H,5,7,9H2,1-4H3,(H,14,15);1H4/b2*11-8+; |
| InChIKey | IEGJXOUBESRYQI-VEAPMNRTSA-N |
| XLogP | 4.15 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|