C22H36N2O2 — CID 59266741
N,N'-bis[(2E)-3,7-dimethylocta-2,6-dienyl]oxamide (PubChem CID 59266741) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is N,N'-bis[(2E)-3,7-dimethylocta-2,6-dienyl]oxamide.
| Compound Name | N,N'-bis[(2E)-3,7-dimethylocta-2,6-dienyl]oxamide |
|---|---|
| PubChem CID | 59266741 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | N,N'-bis[(2E)-3,7-dimethylocta-2,6-dienyl]oxamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)C(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H36N2O2/c1-17(2)9-7-11-19(5)13-15-23-21(25)22(26)24-16-14-20(6)12-8-10-18(3)4/h9-10,13-14H,7-8,11-12,15-16H2,1-6H3,(H,23,25)(H,24,26)/b19-13+,20-14+ |
| InChIKey | FBFVPCAOLCYYBC-IWGRKNQJSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|