C16H27NO6 — CID 91529414
(3R,4R,5S)-N-(3,7-dimethylocta-2,6-dienyl)-3,4,5,6-tetrahydroxy-2-oxohexanamide (PubChem CID 91529414) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is (3R,4R,5S)-N-(3,7-dimethylocta-2,6-dienyl)-3,4,5,6-tetrahydroxy-2-oxohexanamide.
| Compound Name | (3R,4R,5S)-N-(3,7-dimethylocta-2,6-dienyl)-3,4,5,6-tetrahydroxy-2-oxohexanamide |
|---|---|
| PubChem CID | 91529414 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (3R,4R,5S)-N-(3,7-dimethylocta-2,6-dienyl)-3,4,5,6-tetrahydroxy-2-oxohexanamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)C(=O)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C16H27NO6/c1-10(2)5-4-6-11(3)7-8-17-16(23)15(22)14(21)13(20)12(19)9-18/h5,7,12-14,18-21H,4,6,8-9H2,1-3H3,(H,17,23)/t12-,13+,14+/m0/s1 |
| InChIKey | SKZOHBIAEKVTTJ-BFHYXJOUSA-N |
| XLogP | -0.56 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|