C16H27NO6 — CID 87282705
(2S,3S,4S,5R)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4,5-tetrahydroxy-6-oxohexanamide (PubChem CID 87282705) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is (2S,3S,4S,5R)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4,5-tetrahydroxy-6-oxohexanamide.
| Compound Name | (2S,3S,4S,5R)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4,5-tetrahydroxy-6-oxohexanamide |
|---|---|
| PubChem CID | 87282705 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2S,3S,4S,5R)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4,5-tetrahydroxy-6-oxohexanamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C16H27NO6/c1-10(2)5-4-6-11(3)7-8-17-16(23)15(22)14(21)13(20)12(19)9-18/h5,7,9,12-15,19-22H,4,6,8H2,1-3H3,(H,17,23)/b11-7+/t12-,13+,14-,15-/m0/s1 |
| InChIKey | OJHLTVGWQGKECU-XXPIJVFZSA-N |
| XLogP | -0.56 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|