C19H28N2O2 — CID 67134874
(2S)-2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 67134874) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 67134874 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2S)-2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-14(2)5-4-6-15(3)11-12-21-19(23)18(20)13-16-7-9-17(22)10-8-16/h5,7-11,18,22H,4,6,12-13,20H2,1-3H3,(H,21,23)/b15-11+/t18-/m0/s1 |
| InChIKey | ODIDPOSBOUTPLZ-OTMARIDSSA-N |
| XLogP | 3.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|