C23H31NO3 — CID 170919326
methyl (E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamoyl]-4-phenylpent-3-enoate (PubChem CID 170919326) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is methyl (E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamoyl]-4-phenylpent-3-enoate.
| Compound Name | methyl (E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamoyl]-4-phenylpent-3-enoate |
|---|---|
| PubChem CID | 170919326 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | methyl (E)-2-[[(2Z)-3,7-dimethylocta-2,6-dienyl]carbamoyl]-4-phenylpent-3-enoate |
| SMILES | COC(=O)C(/C=C(\C)c1ccccc1)C(=O)NC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C23H31NO3/c1-17(2)10-9-11-18(3)14-15-24-22(25)21(23(26)27-5)16-19(4)20-12-7-6-8-13-20/h6-8,10,12-14,16,21H,9,11,15H2,1-5H3,(H,24,25)/b18-14-,19-16+ |
| InChIKey | LPQXFXSSRUWSEY-PVOXQVLESA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|