2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid

C12H20O3 — CID 173203738

IUPAC2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid
SMILESCC(C)=CCCC(C)=CCC(O)C(=O)O
InChIInChI=1S/C12H20O3/c1-9(2)5-4-6-10(3)7-8-11(13)12(14)15/h5,7,11,13H,4,6,8H2,1-3H3,(H,14,15)
InChIKeyXXXDDLUBOIEPMP-UHFFFAOYSA-N
MW212.29 g/mol
LogP2.51
Rot. Bonds6

About 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid

2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid (PubChem CID 173203738) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid.

Molecular Properties

Compound Name2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid
PubChem CID173203738
Molecular FormulaC12H20O3
Molecular Weight212.29 g/mol
Exact Mass212.14
IUPAC Name2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid
SMILESCC(C)=CCCC(C)=CCC(O)C(=O)O
InChIInChI=1S/C12H20O3/c1-9(2)5-4-6-10(3)7-8-11(13)12(14)15/h5,7,11,13H,4,6,8H2,1-3H3,(H,14,15)
InChIKeyXXXDDLUBOIEPMP-UHFFFAOYSA-N
XLogP2.51
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.29
LogP ≤ 52.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid?
The IUPAC name of 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid (CID 173203738) is 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid.
What is the SMILES notation for 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid?
The canonical SMILES for 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid is CC(C)=CCCC(C)=CCC(O)C(=O)O.
What is the InChIKey of 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid?
The InChIKey is XXXDDLUBOIEPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-9(2)5-4-6-10(3)7-8-11(13)12(14)15/h5,7,11,13H,4,6,8H2,1-3H3,(H,14,15).
What are the key properties of 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid?
2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid has a molecular weight of 212.29 g/mol, XLogP of 2.51, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5,9-dimethyldeca-4,8-dienoic acid is sourced from PubChem (CID 173203738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).