C24H38O4 — CID 23216777
2-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]butanedioic acid (PubChem CID 23216777) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]butanedioic acid.
| Compound Name | 2-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]butanedioic acid |
|---|---|
| PubChem CID | 23216777 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-[(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]butanedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H38O4/c1-17(2)9-7-11-19(5)13-14-21(22(24(27)28)16-23(25)26)15-20(6)12-8-10-18(3)4/h9-10,13,15,21-22H,7-8,11-12,14,16H2,1-6H3,(H,25,26)(H,27,28)/b19-13+,20-15+ |
| InChIKey | DXAHHFIMWONVFT-YLYRKCBPSA-N |
| XLogP | 6.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|