C17H29O5P — CID 54211421
5,9,13-trimethyl-2-phosphonotetradeca-4,8,12-trienoic acid (PubChem CID 54211421) has the molecular formula C17H29O5P and a molecular weight of 344.39 g/mol. Its IUPAC name is 5,9,13-trimethyl-2-phosphonotetradeca-4,8,12-trienoic acid.
| Compound Name | 5,9,13-trimethyl-2-phosphonotetradeca-4,8,12-trienoic acid |
|---|---|
| PubChem CID | 54211421 |
| Molecular Formula | C17H29O5P |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5,9,13-trimethyl-2-phosphonotetradeca-4,8,12-trienoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C17H29O5P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16(17(18)19)23(20,21)22/h7,9,11,16H,5-6,8,10,12H2,1-4H3,(H,18,19)(H2,20,21,22) |
| InChIKey | PWFFIQHCACHKSB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|