C13H22O2S — CID 88700602
(5E)-6,10-dimethyl-3-sulfanylundeca-5,9-dienoic acid (PubChem CID 88700602) has the molecular formula C13H22O2S and a molecular weight of 242.38 g/mol. Its IUPAC name is (5E)-6,10-dimethyl-3-sulfanylundeca-5,9-dienoic acid.
| Compound Name | (5E)-6,10-dimethyl-3-sulfanylundeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 88700602 |
| Molecular Formula | C13H22O2S |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (5E)-6,10-dimethyl-3-sulfanylundeca-5,9-dienoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC(S)CC(=O)O |
| InChI | InChI=1S/C13H22O2S/c1-10(2)5-4-6-11(3)7-8-12(16)9-13(14)15/h5,7,12,16H,4,6,8-9H2,1-3H3,(H,14,15)/b11-7+ |
| InChIKey | YWSSVUXTBBFQLG-YRNVUSSQSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|