C22H35NO — CID 102358163
(4E)-N-(2-adamantyl)-5,9-dimethyldeca-4,8-dienamide (PubChem CID 102358163) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is (4E)-N-(2-adamantyl)-5,9-dimethyldeca-4,8-dienamide.
| Compound Name | (4E)-N-(2-adamantyl)-5,9-dimethyldeca-4,8-dienamide |
|---|---|
| PubChem CID | 102358163 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (4E)-N-(2-adamantyl)-5,9-dimethyldeca-4,8-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/CCC(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H35NO/c1-15(2)6-4-7-16(3)8-5-9-21(24)23-22-19-11-17-10-18(13-19)14-20(22)12-17/h6,8,17-20,22H,4-5,7,9-14H2,1-3H3,(H,23,24)/b16-8+ |
| InChIKey | SBPNOHQPHBFHMD-LZYBPNLTSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|