C22H38N2 — CID 175165055
2-N-(2-adamantyl)-5,9-dimethyldeca-4,8-diene-1,2-diamine (PubChem CID 175165055) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 2-N-(2-adamantyl)-5,9-dimethyldeca-4,8-diene-1,2-diamine.
| Compound Name | 2-N-(2-adamantyl)-5,9-dimethyldeca-4,8-diene-1,2-diamine |
|---|---|
| PubChem CID | 175165055 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | 2-N-(2-adamantyl)-5,9-dimethyldeca-4,8-diene-1,2-diamine |
| SMILES | CC(C)=CCCC(C)=CCC(CN)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H38N2/c1-15(2)5-4-6-16(3)7-8-21(14-23)24-22-19-10-17-9-18(12-19)13-20(22)11-17/h5,7,17-22,24H,4,6,8-14,23H2,1-3H3 |
| InChIKey | GKPBGMVYVFDDKJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|