C30H50 — CID 100918373
(2S)-1,1-dimethyl-3-methylidene-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexane (PubChem CID 100918373) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (2S)-1,1-dimethyl-3-methylidene-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexane.
| Compound Name | (2S)-1,1-dimethyl-3-methylidene-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexane |
|---|---|
| PubChem CID | 100918373 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (2S)-1,1-dimethyl-3-methylidene-2-[(3E,7E,11E)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]cyclohexane |
| SMILES | C=C1CCCC(C)(C)[C@@H]1CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50/c1-24(2)14-11-17-26(4)19-12-18-25(3)15-9-10-16-27(5)21-22-29-28(6)20-13-23-30(29,7)8/h14-16,19,29H,6,9-13,17-18,20-23H2,1-5,7-8H3/b25-15+,26-19+,27-16+/t29-/m1/s1 |
| InChIKey | UVIZUYAYNKEOSX-DGZICKBDSA-N |
| XLogP | 10.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|