C30H50 — CID 162998240
8-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalene (PubChem CID 162998240) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is 8-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalene.
| Compound Name | 8-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 162998240 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | 8-[6-(2,2-dimethyl-6-methylidenecyclohexyl)-4-methylhex-3-enyl]-4,4,7,8a-tetramethyl-1,2,3,4a,5,6-hexahydronaphthalene |
| SMILES | C=C1CCCC(C)(C)C1CCC(C)=CCCC1=C(C)CCC2C(C)(C)CCCC12C |
| InChI | InChI=1S/C30H50/c1-22(15-17-25-23(2)13-10-19-28(25,4)5)12-9-14-26-24(3)16-18-27-29(6,7)20-11-21-30(26,27)8/h12,25,27H,2,9-11,13-21H2,1,3-8H3 |
| InChIKey | XJIWHEYJSIWXQF-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|