C30H50 — CID 132559350
(2S)-2-[(3E,7E)-10-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]-3,8-dimethyldeca-3,7-dienyl]-1,1-dimethyl-3-methylidenecyclohexane (PubChem CID 132559350) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (2S)-2-[(3E,7E)-10-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]-3,8-dimethyldeca-3,7-dienyl]-1,1-dimethyl-3-methylidenecyclohexane.
| Compound Name | (2S)-2-[(3E,7E)-10-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]-3,8-dimethyldeca-3,7-dienyl]-1,1-dimethyl-3-methylidenecyclohexane |
|---|---|
| PubChem CID | 132559350 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (2S)-2-[(3E,7E)-10-[(1S)-2,2-dimethyl-6-methylidenecyclohexyl]-3,8-dimethyldeca-3,7-dienyl]-1,1-dimethyl-3-methylidenecyclohexane |
| SMILES | C=C1CCCC(C)(C)[C@@H]1CC/C(C)=C/CC/C=C(\C)CC[C@@H]1C(=C)CCCC1(C)C |
| InChI | InChI=1S/C30H50/c1-23(17-19-27-25(3)15-11-21-29(27,5)6)13-9-10-14-24(2)18-20-28-26(4)16-12-22-30(28,7)8/h13-14,27-28H,3-4,9-12,15-22H2,1-2,5-8H3/b23-13+,24-14+/t27-,28-/m1/s1 |
| InChIKey | LLNYAGWEGAJLPY-RVVOWCJMSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|