C20H34O2 — CID 162888501
5-[3-[2-(2,2-dimethyl-6-methylidenecyclohexyl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-en-1-ol (PubChem CID 162888501) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 5-[3-[2-(2,2-dimethyl-6-methylidenecyclohexyl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-en-1-ol.
| Compound Name | 5-[3-[2-(2,2-dimethyl-6-methylidenecyclohexyl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-en-1-ol |
|---|---|
| PubChem CID | 162888501 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 5-[3-[2-(2,2-dimethyl-6-methylidenecyclohexyl)ethyl]-3-methyloxiran-2-yl]-3-methylpent-2-en-1-ol |
| SMILES | C=C1CCCC(C)(C)C1CCC1(C)OC1CCC(C)=CCO |
| InChI | InChI=1S/C20H34O2/c1-15(11-14-21)8-9-18-20(5,22-18)13-10-17-16(2)7-6-12-19(17,3)4/h11,17-18,21H,2,6-10,12-14H2,1,3-5H3 |
| InChIKey | YYAIRMIMEMGTKV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|