C20H34O2 — CID 162987726
[(2R,3R)-3-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-3-methyloxiran-2-yl]methanol (PubChem CID 162987726) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is [(2R,3R)-3-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-3-methyloxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-3-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 162987726 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | [(2R,3R)-3-[2-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-3-methyloxiran-2-yl]methanol |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(C)O[C@@H]1CO |
| InChI | InChI=1S/C20H34O2/c1-14-7-8-16-18(2,3)10-6-11-19(16,4)15(14)9-12-20(5)17(13-21)22-20/h15-17,21H,1,6-13H2,2-5H3/t15-,16-,17+,19-,20+/m0/s1 |
| InChIKey | CLZNLMCOGWTWKC-VBYALHQYSA-N |
| XLogP | 4.72 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|