C26H44O — CID 57232099
5,10,14,18-tetramethylnonadeca-5,9,13,17-tetraenoxycyclopropane (PubChem CID 57232099) has the molecular formula C26H44O and a molecular weight of 372.64 g/mol. Its IUPAC name is 5,10,14,18-tetramethylnonadeca-5,9,13,17-tetraenoxycyclopropane.
| Compound Name | 5,10,14,18-tetramethylnonadeca-5,9,13,17-tetraenoxycyclopropane |
|---|---|
| PubChem CID | 57232099 |
| Molecular Formula | C26H44O |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | 5,10,14,18-tetramethylnonadeca-5,9,13,17-tetraenoxycyclopropane |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCCCOC1CC1 |
| InChI | InChI=1S/C26H44O/c1-22(2)12-10-16-25(5)18-11-17-24(4)14-7-6-13-23(3)15-8-9-21-27-26-19-20-26/h12-14,18,26H,6-11,15-17,19-21H2,1-5H3 |
| InChIKey | VJKZFBCIWLTTLS-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|