C14H23ClN2O2 — CID 123912701
3-chloro-5-methylidene-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide (PubChem CID 123912701) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 3-chloro-5-methylidene-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 3-chloro-5-methylidene-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123912701 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-chloro-5-methylidene-N-(2-morpholin-4-ylethyl)cyclohexane-1-carboxamide |
| SMILES | C=C1CC(Cl)CC(C(=O)NCCN2CCOCC2)C1 |
| InChI | InChI=1S/C14H23ClN2O2/c1-11-8-12(10-13(15)9-11)14(18)16-2-3-17-4-6-19-7-5-17/h12-13H,1-10H2,(H,16,18) |
| InChIKey | VKNCTFJOMSGJFI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|