C33H54O2 — CID 162436791
3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;formic acid (PubChem CID 162436791) has the molecular formula C33H54O2 and a molecular weight of 482.79 g/mol. Its IUPAC name is 3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;formic acid.
| Compound Name | 3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;formic acid |
|---|---|
| PubChem CID | 162436791 |
| Molecular Formula | C33H54O2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | 3-[(6E)-7,11-dimethyl-3-methylidenedodeca-6,10-dienyl]-1-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohexene;formic acid |
| SMILES | C=C(CC/C=C(\C)CCC=C(C)C)CCC1C=C(CC/C=C(\C)CCC=C(C)C)CCC1.O=CO |
| InChI | InChI=1S/C32H52.CH2O2/c1-26(2)13-8-15-28(5)17-10-18-30(7)23-24-32-22-12-21-31(25-32)20-11-19-29(6)16-9-14-27(3)4;2-1-3/h13-14,17,19,25,32H,7-12,15-16,18,20-24H2,1-6H3;1H,(H,2,3)/b28-17+,29-19+; |
| InChIKey | PMEMXPXZDRXJDZ-ZBAXSOIUSA-N |
| XLogP | 10.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|