C16H28O — CID 142081315
acetaldehyde;(3R,4R)-3,4-dimethyl-1-(4-methylpent-3-enyl)cyclohexene (PubChem CID 142081315) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is acetaldehyde;(3R,4R)-3,4-dimethyl-1-(4-methylpent-3-enyl)cyclohexene.
| Compound Name | acetaldehyde;(3R,4R)-3,4-dimethyl-1-(4-methylpent-3-enyl)cyclohexene |
|---|---|
| PubChem CID | 142081315 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | acetaldehyde;(3R,4R)-3,4-dimethyl-1-(4-methylpent-3-enyl)cyclohexene |
| SMILES | CC(C)=CCCC1=C[C@H](C)[C@H](C)CC1.CC=O |
| InChI | InChI=1S/C14H24.C2H4O/c1-11(2)6-5-7-14-9-8-12(3)13(4)10-14;1-2-3/h6,10,12-13H,5,7-9H2,1-4H3;2H,1H3/t12-,13+;/m1./s1 |
| InChIKey | XCNVFOJUFZUUPU-KZCZEQIWSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|