C33H52O4 — CID 25317595
9-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 25317595) has the molecular formula C33H52O4 and a molecular weight of 512.78 g/mol. Its IUPAC name is 9-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 9-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 25317595 |
| Molecular Formula | C33H52O4 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | 9-[(1S,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-3-[(1R,6S)-6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | CC(C)=CCCC1=CC[C@H](C2OCC3(CO2)COC([C@@H]2CC=C(CCC=C(C)C)C[C@@H]2C)OC3)[C@@H](C)C1 |
| InChI | InChI=1S/C33H52O4/c1-23(2)9-7-11-27-13-15-29(25(5)17-27)31-34-19-33(20-35-31)21-36-32(37-22-33)30-16-14-28(18-26(30)6)12-8-10-24(3)4/h9-10,13-14,25-26,29-32H,7-8,11-12,15-22H2,1-6H3/t25-,26-,29-,30+,31?,32?,33?/m0/s1 |
| InChIKey | JNVXTJUARFISBH-JFINRKQOSA-N |
| XLogP | 8.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|