C16H25NO — CID 91058261
(4aS,8aR)-6-(4-methylpent-3-enyl)-1-nitroso-1,2,3,4,4a,5,8,8a-octahydronaphthalene (PubChem CID 91058261) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (4aS,8aR)-6-(4-methylpent-3-enyl)-1-nitroso-1,2,3,4,4a,5,8,8a-octahydronaphthalene.
| Compound Name | (4aS,8aR)-6-(4-methylpent-3-enyl)-1-nitroso-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 91058261 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (4aS,8aR)-6-(4-methylpent-3-enyl)-1-nitroso-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
| SMILES | CC(C)=CCCC1=CC[C@H]2C(N=O)CCC[C@H]2C1 |
| InChI | InChI=1S/C16H25NO/c1-12(2)5-3-6-13-9-10-15-14(11-13)7-4-8-16(15)17-18/h5,9,14-16H,3-4,6-8,10-11H2,1-2H3/t14-,15+,16?/m0/s1 |
| InChIKey | IMBREYUKFCRUFR-QMRHZFGWSA-N |
| XLogP | 5.00 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|