C18H30 — CID 169000974
(4S)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylcyclohexene (PubChem CID 169000974) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is (4S)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylcyclohexene.
| Compound Name | (4S)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylcyclohexene |
|---|---|
| PubChem CID | 169000974 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (4S)-1-[(3E)-4,8-dimethylnona-3,7-dienyl]-4-methylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=CC[C@@H](C)CC1 |
| InChI | InChI=1S/C18H30/c1-15(2)7-5-8-16(3)9-6-10-18-13-11-17(4)12-14-18/h7,9,13,17H,5-6,8,10-12,14H2,1-4H3/b16-9+/t17-/m1/s1 |
| InChIKey | OWYREVZVHFQMMR-JDZKTDJGSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|