C30H48 — CID 76580476
1,5-bis(4,8-dimethylnona-3,7-dienyl)-5-ethenylcyclohexene (PubChem CID 76580476) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is 1,5-bis(4,8-dimethylnona-3,7-dienyl)-5-ethenylcyclohexene.
| Compound Name | 1,5-bis(4,8-dimethylnona-3,7-dienyl)-5-ethenylcyclohexene |
|---|---|
| PubChem CID | 76580476 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | 1,5-bis(4,8-dimethylnona-3,7-dienyl)-5-ethenylcyclohexene |
| SMILES | C=CC1(CCC=C(C)CCC=C(C)C)CCC=C(CCC=C(C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C30H48/c1-8-30(22-12-19-28(7)17-10-15-26(4)5)23-13-21-29(24-30)20-11-18-27(6)16-9-14-25(2)3/h8,14-15,18-19,21H,1,9-13,16-17,20,22-24H2,2-7H3 |
| InChIKey | SIQOXBZZKDYYHJ-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|