C16H26O2 — CID 102105202
(4aR,8aS)-6-(4-methylpent-3-enyl)-1,2,3,4,5,8-hexahydronaphthalene-4a,8a-diol (PubChem CID 102105202) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (4aR,8aS)-6-(4-methylpent-3-enyl)-1,2,3,4,5,8-hexahydronaphthalene-4a,8a-diol.
| Compound Name | (4aR,8aS)-6-(4-methylpent-3-enyl)-1,2,3,4,5,8-hexahydronaphthalene-4a,8a-diol |
|---|---|
| PubChem CID | 102105202 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (4aR,8aS)-6-(4-methylpent-3-enyl)-1,2,3,4,5,8-hexahydronaphthalene-4a,8a-diol |
| SMILES | CC(C)=CCCC1=CC[C@@]2(O)CCCC[C@@]2(O)C1 |
| InChI | InChI=1S/C16H26O2/c1-13(2)6-5-7-14-8-11-15(17)9-3-4-10-16(15,18)12-14/h6,8,17-18H,3-5,7,9-12H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | OUNUMCYWXILYLE-JKSUJKDBSA-N |
| XLogP | 3.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|