C33H54 — CID 91034090
4-(4,8-dimethyldodeca-3,7-dienyl)-1-(4,8-dimethylnona-3,7-dienyl)-4-ethenylcyclohexene (PubChem CID 91034090) has the molecular formula C33H54 and a molecular weight of 450.80 g/mol. Its IUPAC name is 4-(4,8-dimethyldodeca-3,7-dienyl)-1-(4,8-dimethylnona-3,7-dienyl)-4-ethenylcyclohexene.
| Compound Name | 4-(4,8-dimethyldodeca-3,7-dienyl)-1-(4,8-dimethylnona-3,7-dienyl)-4-ethenylcyclohexene |
|---|---|
| PubChem CID | 91034090 |
| Molecular Formula | C33H54 |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | 4-(4,8-dimethyldodeca-3,7-dienyl)-1-(4,8-dimethylnona-3,7-dienyl)-4-ethenylcyclohexene |
| SMILES | C=CC1(CCC=C(C)CCC=C(C)CCCC)CC=C(CCC=C(C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C33H54/c1-8-10-16-29(5)18-12-19-31(7)21-14-25-33(9-2)26-23-32(24-27-33)22-13-20-30(6)17-11-15-28(3)4/h9,15,18,20-21,23H,2,8,10-14,16-17,19,22,24-27H2,1,3-7H3 |
| InChIKey | YABOXWRCAOGPCP-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|