C19H36P+ — CID 158266649
butyl-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphanium (PubChem CID 158266649) has the molecular formula C19H36P+ and a molecular weight of 295.47 g/mol. Its IUPAC name is butyl-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphanium.
| Compound Name | butyl-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphanium |
|---|---|
| PubChem CID | 158266649 |
| Molecular Formula | C19H36P+ |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | butyl-[(6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]phosphanium |
| SMILES | CCCC[PH2+]CC=C(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H35P/c1-6-7-15-20-16-14-19(5)13-9-12-18(4)11-8-10-17(2)3/h10,12,14,20H,6-9,11,13,15-16H2,1-5H3/p+1/b18-12+,19-14? |
| InChIKey | GININTQJQDVHBQ-KNUFITIJSA-O |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|