C26H50 — CID 162079708
(6E)-2,6-dimethyldeca-2,6-diene;2-methylhex-1-ene;2-methylhex-2-ene (PubChem CID 162079708) has the molecular formula C26H50 and a molecular weight of 362.69 g/mol. Its IUPAC name is (6E)-2,6-dimethyldeca-2,6-diene;2-methylhex-1-ene;2-methylhex-2-ene.
| Compound Name | (6E)-2,6-dimethyldeca-2,6-diene;2-methylhex-1-ene;2-methylhex-2-ene |
|---|---|
| PubChem CID | 162079708 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | (6E)-2,6-dimethyldeca-2,6-diene;2-methylhex-1-ene;2-methylhex-2-ene |
| SMILES | C=C(C)CCCC.CCC/C=C(\C)CCC=C(C)C.CCCC=C(C)C |
| InChI | InChI=1S/C12H22.2C7H14/c1-5-6-9-12(4)10-7-8-11(2)3;2*1-4-5-6-7(2)3/h8-9H,5-7,10H2,1-4H3;6H,4-5H2,1-3H3;2,4-6H2,1,3H3/b12-9+;; |
| InChIKey | ZCEDTMJURKXWSV-ANOGCNOSSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|