C27H44O4 — CID 90326837
dibutyl (1R,2S)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 90326837) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is dibutyl (1R,2S)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dibutyl (1R,2S)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90326837 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | dibutyl (1R,2S)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)[C@H]1CC(CC/C=C(\C)CCC=C(C)C)=CC[C@H]1C(=O)OCCCC |
| InChI | InChI=1S/C27H44O4/c1-6-8-18-30-26(28)24-17-16-23(20-25(24)27(29)31-19-9-7-2)15-11-14-22(5)13-10-12-21(3)4/h12,14,16,24-25H,6-11,13,15,17-20H2,1-5H3/b22-14+/t24-,25+/m1/s1 |
| InChIKey | MEABRIQQJJQTGQ-BGNTWFOQSA-N |
| XLogP | 7.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|