C26H44O5 — CID 88925503
2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate (PubChem CID 88925503) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 88925503 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]ethyl 4-[(3E)-4,8-dimethylnona-3,7-dienyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOCCOCCOCCOC(=O)C1CC=C(CC/C=C(\C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C26H44O5/c1-5-28-16-17-29-18-19-30-20-21-31-26(27)25-14-12-24(13-15-25)11-7-10-23(4)9-6-8-22(2)3/h8,10,12,25H,5-7,9,11,13-21H2,1-4H3/b23-10+ |
| InChIKey | MQOXZPFLOFAAIO-AUEPDCJTSA-N |
| XLogP | 5.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|