C49H82O3S2 — CID 167032311
6-[8-[6-[cyclopropylidene-[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]hexylsulfanyl]octylsulfanyl]hexyl 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate (PubChem CID 167032311) has the molecular formula C49H82O3S2 and a molecular weight of 783.33 g/mol. Its IUPAC name is 6-[8-[6-[cyclopropylidene-[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]hexylsulfanyl]octylsulfanyl]hexyl 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | 6-[8-[6-[cyclopropylidene-[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]hexylsulfanyl]octylsulfanyl]hexyl 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 167032311 |
| Molecular Formula | C49H82O3S2 |
| Molecular Weight | 783.33 g/mol |
| Exact Mass | 782.57 |
| IUPAC Name | 6-[8-[6-[cyclopropylidene-[4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methoxy]hexylsulfanyl]octylsulfanyl]hexyl 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)=CCCC1=CCC(C(=O)OCCCCCCSCCCCCCCCSCCCCCCOC(=C2CC2)C2CC=C(CCC=C(C)C)CC2)CC1 |
| InChI | InChI=1S/C49H82O3S2/c1-41(2)21-19-23-43-25-29-45(30-26-43)48(46-33-34-46)51-35-13-7-11-17-39-53-37-15-9-5-6-10-16-38-54-40-18-12-8-14-36-52-49(50)47-31-27-44(28-32-47)24-20-22-42(3)4/h21-22,25,27,45,47H,5-20,23-24,26,28-40H2,1-4H3 |
| InChIKey | IDQXEWYJILPWKK-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.33 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|