C19H28O4 — CID 123926902
dimethyl 4-(4-methylocta-3,7-dienyl)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 123926902) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is dimethyl 4-(4-methylocta-3,7-dienyl)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(4-methylocta-3,7-dienyl)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 123926902 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | dimethyl 4-(4-methylocta-3,7-dienyl)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | C=CCCC(C)=CCCC1=CCC(C(=O)OC)C(C(=O)OC)C1 |
| InChI | InChI=1S/C19H28O4/c1-5-6-8-14(2)9-7-10-15-11-12-16(18(20)22-3)17(13-15)19(21)23-4/h5,9,11,16-17H,1,6-8,10,12-13H2,2-4H3 |
| InChIKey | FPPKAMYVZSLYIG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|