C18H28O4 — CID 163556898
dimethyl 4-(6-methylhept-5-en-2-yl)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 163556898) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is dimethyl 4-(6-methylhept-5-en-2-yl)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(6-methylhept-5-en-2-yl)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 163556898 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | dimethyl 4-(6-methylhept-5-en-2-yl)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC=C(C(C)CCC=C(C)C)CC1C(=O)OC |
| InChI | InChI=1S/C18H28O4/c1-12(2)7-6-8-13(3)14-9-10-15(17(19)21-4)16(11-14)18(20)22-5/h7,9,13,15-16H,6,8,10-11H2,1-5H3 |
| InChIKey | FNVSJHSSQGYMOX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|