C30H36O12 — CID 7163303
hexamethyl (2S,3R,6R,7S,10S,11R)-1,2,3,4,5,6,7,8,9,10,11,12-dodecahydrotriphenylene-2,3,6,7,10,11-hexacarboxylate (PubChem CID 7163303) has the molecular formula C30H36O12 and a molecular weight of 588.61 g/mol. Its IUPAC name is hexamethyl (2S,3R,6R,7S,10S,11R)-1,2,3,4,5,6,7,8,9,10,11,12-dodecahydrotriphenylene-2,3,6,7,10,11-hexacarboxylate.
| Compound Name | hexamethyl (2S,3R,6R,7S,10S,11R)-1,2,3,4,5,6,7,8,9,10,11,12-dodecahydrotriphenylene-2,3,6,7,10,11-hexacarboxylate |
|---|---|
| PubChem CID | 7163303 |
| Molecular Formula | C30H36O12 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | hexamethyl (2S,3R,6R,7S,10S,11R)-1,2,3,4,5,6,7,8,9,10,11,12-dodecahydrotriphenylene-2,3,6,7,10,11-hexacarboxylate |
| SMILES | COC(=O)[C@H]1Cc2c3c(c4c(c2C[C@H]1C(=O)OC)C[C@H](C(=O)OC)[C@H](C(=O)OC)C4)C[C@@H](C(=O)OC)[C@@H](C(=O)OC)C3 |
| InChI | InChI=1S/C30H36O12/c1-37-25(31)19-7-13-14(8-20(19)26(32)38-2)16-10-22(28(34)40-4)24(30(36)42-6)12-18(16)17-11-23(29(35)41-5)21(9-15(13)17)27(33)39-3/h19-24H,7-12H2,1-6H3/t19-,20+,21-,22-,23+,24+ |
| InChIKey | NGBDEACOKBXKEI-MQLGOCQLSA-N |
| XLogP | 0.72 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|