C18H22O9 — CID 10691288
tetramethyl (1S,8R,9R,10R)-11-oxatricyclo[6.2.1.02,7]undec-2(7)-ene-4,5,9,10-tetracarboxylate (PubChem CID 10691288) has the molecular formula C18H22O9 and a molecular weight of 382.37 g/mol. Its IUPAC name is tetramethyl (1S,8R,9R,10R)-11-oxatricyclo[6.2.1.02,7]undec-2(7)-ene-4,5,9,10-tetracarboxylate.
| Compound Name | tetramethyl (1S,8R,9R,10R)-11-oxatricyclo[6.2.1.02,7]undec-2(7)-ene-4,5,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 10691288 |
| Molecular Formula | C18H22O9 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | tetramethyl (1S,8R,9R,10R)-11-oxatricyclo[6.2.1.02,7]undec-2(7)-ene-4,5,9,10-tetracarboxylate |
| SMILES | COC(=O)C1CC2=C(CC1C(=O)OC)[C@@H]1O[C@H]2[C@H](C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H22O9/c1-23-15(19)9-5-7-8(6-10(9)16(20)24-2)14-12(18(22)26-4)11(13(7)27-14)17(21)25-3/h9-14H,5-6H2,1-4H3/t9?,10?,11-,12-,13-,14+/m1/s1 |
| InChIKey | LOUVKYRUPCJIHP-IJIPSMSCSA-N |
| XLogP | 0.01 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|