C19H22O5 — CID 102006500
dimethyl (2R,5S,6R,7R,7aS)-5-methyl-2-phenyl-2,3,5,6,7,7a-hexahydro-1-benzofuran-6,7-dicarboxylate (PubChem CID 102006500) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is dimethyl (2R,5S,6R,7R,7aS)-5-methyl-2-phenyl-2,3,5,6,7,7a-hexahydro-1-benzofuran-6,7-dicarboxylate.
| Compound Name | dimethyl (2R,5S,6R,7R,7aS)-5-methyl-2-phenyl-2,3,5,6,7,7a-hexahydro-1-benzofuran-6,7-dicarboxylate |
|---|---|
| PubChem CID | 102006500 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | dimethyl (2R,5S,6R,7R,7aS)-5-methyl-2-phenyl-2,3,5,6,7,7a-hexahydro-1-benzofuran-6,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H](C)C=C2C[C@H](c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C19H22O5/c1-11-9-13-10-14(12-7-5-4-6-8-12)24-17(13)16(19(21)23-3)15(11)18(20)22-2/h4-9,11,14-17H,10H2,1-3H3/t11-,14+,15+,16+,17+/m0/s1 |
| InChIKey | SHBAVXSBDMUKIG-WVRYCFJFSA-N |
| XLogP | 2.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|