C15H14O7 — CID 10804569
dimethyl (1S,11R,12R,13S)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate (PubChem CID 10804569) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is dimethyl (1S,11R,12R,13S)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate.
| Compound Name | dimethyl (1S,11R,12R,13S)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate |
|---|---|
| PubChem CID | 10804569 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | dimethyl (1S,11R,12R,13S)-5,7,14-trioxatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4(8),9-triene-12,13-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H]2O[C@H]1c1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H14O7/c1-18-14(16)10-11(15(17)19-2)13-7-4-9-8(20-5-21-9)3-6(7)12(10)22-13/h3-4,10-13H,5H2,1-2H3/t10-,11+,12+,13- |
| InChIKey | HXYUARMDGHPGJB-FNFFVJSTSA-N |
| XLogP | 1.12 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |