C23H16O3 — CID 11359753
(1S,2R,15S,16R)-20,22,26-trioxaheptacyclo[14.9.1.02,15.03,8.09,14.017,25.019,23]hexacosa-3,5,7,9,11,13,17,19(23),24-nonaene (PubChem CID 11359753) has the molecular formula C23H16O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1S,2R,15S,16R)-20,22,26-trioxaheptacyclo[14.9.1.02,15.03,8.09,14.017,25.019,23]hexacosa-3,5,7,9,11,13,17,19(23),24-nonaene.
| Compound Name | (1S,2R,15S,16R)-20,22,26-trioxaheptacyclo[14.9.1.02,15.03,8.09,14.017,25.019,23]hexacosa-3,5,7,9,11,13,17,19(23),24-nonaene |
|---|---|
| PubChem CID | 11359753 |
| Molecular Formula | C23H16O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (1S,2R,15S,16R)-20,22,26-trioxaheptacyclo[14.9.1.02,15.03,8.09,14.017,25.019,23]hexacosa-3,5,7,9,11,13,17,19(23),24-nonaene |
| SMILES | c1ccc2c(c1)-c1ccccc1[C@H]1[C@@H]2[C@H]2O[C@@H]1c1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C23H16O3/c1-3-7-14-12(5-1)13-6-2-4-8-15(13)21-20(14)22-16-9-18-19(25-11-24-18)10-17(16)23(21)26-22/h1-10,20-23H,11H2/t20-,21+,22+,23- |
| InChIKey | BPGIIRYLPZEFGZ-ZCQNZVIGSA-N |
| XLogP | 5.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |