C21H15NO3 — CID 92537798
(9S)-2-(1,3-benzodioxol-5-ylmethylideneamino)-9H-fluoren-9-ol (PubChem CID 92537798) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (9S)-2-(1,3-benzodioxol-5-ylmethylideneamino)-9H-fluoren-9-ol.
| Compound Name | (9S)-2-(1,3-benzodioxol-5-ylmethylideneamino)-9H-fluoren-9-ol |
|---|---|
| PubChem CID | 92537798 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (9S)-2-(1,3-benzodioxol-5-ylmethylideneamino)-9H-fluoren-9-ol |
| SMILES | O[C@H]1c2ccccc2-c2ccc(/N=C/c3ccc4c(c3)OCO4)cc21 |
| InChI | InChI=1S/C21H15NO3/c23-21-17-4-2-1-3-15(17)16-7-6-14(10-18(16)21)22-11-13-5-8-19-20(9-13)25-12-24-19/h1-11,21,23H,12H2/b22-11+/t21-/m0/s1 |
| InChIKey | XRSVANNHTJTWGJ-IQTGRTGDSA-N |
| XLogP | 4.23 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|