C18H16N6O4 — CID 98572403
1-N',2-N'-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]ethanediimidamide (PubChem CID 98572403) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-N',2-N'-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]ethanediimidamide.
| Compound Name | 1-N',2-N'-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]ethanediimidamide |
|---|---|
| PubChem CID | 98572403 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-N',2-N'-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]ethanediimidamide |
| SMILES | NC(=N/N=C/c1ccc2c(c1)OCO2)C(N)=N/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16N6O4/c19-17(23-21-7-11-1-3-13-15(5-11)27-9-25-13)18(20)24-22-8-12-2-4-14-16(6-12)28-10-26-14/h1-8H,9-10H2,(H2,19,23)(H2,20,24)/b21-7+,22-8+ |
| InChIKey | VLIUHPJBSSDYLH-KVJLFNRQSA-N |
| XLogP | 1.23 |
| TPSA | 138.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|