C14H10Cl2N4O3 — CID 76852124
1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-(2,6-dichloro-4-pyridinyl)urea (PubChem CID 76852124) has the molecular formula C14H10Cl2N4O3 and a molecular weight of 353.17 g/mol. Its IUPAC name is 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-(2,6-dichloro-4-pyridinyl)urea.
| Compound Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-(2,6-dichloro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 76852124 |
| Molecular Formula | C14H10Cl2N4O3 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 1-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-(2,6-dichloro-4-pyridinyl)urea |
| SMILES | NC(=O)N(/N=C/c1ccc2c(c1)OCO2)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N4O3/c15-12-4-9(5-13(16)19-12)20(14(17)21)18-6-8-1-2-10-11(3-8)23-7-22-10/h1-6H,7H2,(H2,17,21)/b18-6+ |
| InChIKey | DICIHGVVGWXTLN-NGYBGAFCSA-N |
| XLogP | 3.04 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|